* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 103_Y02A065 |
English Synonyms: | WUXI-NATURAL 103_Y02A065 |
MDL Number.: | MFCD21334113 |
H bond acceptor: | 7 |
H bond donor: | 0 |
Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(C[C@@H]6[C@H](C5(C)C)N(CCN6C(=O)c7ccc8c(c7)OCO8)C)C)C)C2C1)C)C(=O)OC)C |
InChi: | InChI=1S/C42H60N2O5/c1-37(2)16-18-42(36(46)47-9)19-17-40(6)27(28(42)23-37)11-13-33-39(5)24-29-34(38(3,4)32(39)14-15-41(33,40)7)43(8)20-21-44(29)35(45)26-10-12-30-31(22-26)49-25-48-30/h10-12,22,28-29,32-34H,13-21,23-25H2,1-9H3/t28?,29-,32?,33?,34-,39+,40-,41-,42+/m1/s1 |
InChiKey: | InChIKey=DWOHLYPXJOSQHJ-DFJPHIPJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.