* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 103_Y02A066 |
English Synonyms: | WUXI-NATURAL 103_Y02A066 |
MDL Number.: | MFCD21334114 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(C[C@@H]6[C@H](C5(C)C)N(CCN6C(=O)Cc7cccc(c7)OC)C)C)C)C2C1)C)C(=O)OC)C |
InChi: | InChI=1S/C43H64N2O4/c1-38(2)18-20-43(37(47)49-10)21-19-41(6)30(31(43)26-38)14-15-34-40(5)27-32-36(39(3,4)33(40)16-17-42(34,41)7)44(8)22-23-45(32)35(46)25-28-12-11-13-29(24-28)48-9/h11-14,24,31-34,36H,15-23,25-27H2,1-10H3/t31?,32-,33?,34?,36-,40+,41-,42-,43+/m1/s1 |
InChiKey: | InChIKey=PIJPNSMOTSNMJK-OGOVXDSSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.