* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 103_Y02A070 |
English Synonyms: | WUXI-NATURAL 103_Y02A070 |
MDL Number.: | MFCD21334118 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | Cc1ccc(cc1F)C(=O)N2CCN([C@@H]3[C@H]2C[C@]4(C(C3(C)C)CC[C@@]5(C4CC=C6[C@]5(CC[C@@]7(C6CC(CC7)(C)C)C(=O)OC)C)C)C)C |
InChi: | InChI=1S/C42H61FN2O3/c1-26-11-12-27(23-30(26)43)35(46)45-22-21-44(9)34-31(45)25-39(6)32(38(34,4)5)15-16-41(8)33(39)14-13-28-29-24-37(2,3)17-19-42(29,36(47)48-10)20-18-40(28,41)7/h11-13,23,29,31-34H,14-22,24-25H2,1-10H3/t29?,31-,32?,33?,34-,39+,40-,41-,42+/m1/s1 |
InChiKey: | InChIKey=KLKBXMRCTUBNNC-CUWUFNGOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.