* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 103_Y02A076 |
English Synonyms: | WUXI-NATURAL 103_Y02A076 |
MDL Number.: | MFCD21334124 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(C[C@@H]6[C@H](C5(C)C)N(CCN6CCc7ccccc7)C)C)C)C2C1)C)C(=O)OC)C |
InChi: | InChI=1S/C42H64N2O2/c1-37(2)20-22-42(36(45)46-9)23-21-40(6)30(31(42)27-37)15-16-34-39(5)28-32-35(38(3,4)33(39)17-19-41(34,40)7)43(8)25-26-44(32)24-18-29-13-11-10-12-14-29/h10-15,31-35H,16-28H2,1-9H3/t31?,32-,33?,34?,35-,39+,40-,41-,42+/m1/s1 |
InChiKey: | InChIKey=YNBNZJBHICAIDM-SNHVRQNRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.