* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 103_Y02A077 |
English Synonyms: | WUXI-NATURAL 103_Y02A077 |
MDL Number.: | MFCD21334125 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | Cc1cc(oc1C)CN2CCN([C@@H]3[C@H]2C[C@]4(C(C3(C)C)CC[C@@]5(C4CC=C6[C@]5(CC[C@@]7(C6CC(CC7)(C)C)C(=O)OC)C)C)C)C |
InChi: | InChI=1S/C41H64N2O3/c1-26-22-28(46-27(26)2)25-43-21-20-42(10)34-31(43)24-38(7)32(37(34,5)6)14-15-40(9)33(38)13-12-29-30-23-36(3,4)16-18-41(30,35(44)45-11)19-17-39(29,40)8/h12,22,30-34H,13-21,23-25H2,1-11H3/t30?,31-,32?,33?,34-,38+,39-,40-,41+/m1/s1 |
InChiKey: | InChIKey=CSUZRDLIOOMXFJ-NTXKOIRTSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.