* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXI-NATURAL 103_Y02A082 |
| English Synonyms: | WUXI-NATURAL 103_Y02A082 |
| MDL Number.: | MFCD21334130 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(C[C@@H]6[C@H](C5(C)C)N(CCN6CC7CCCCC7)C)C)C)C2C1)C)C(=O)OC)C |
| InChi: | InChI=1S/C41H68N2O2/c1-36(2)19-21-41(35(44)45-9)22-20-39(6)29(30(41)25-36)15-16-33-38(5)26-31-34(37(3,4)32(38)17-18-40(33,39)7)42(8)23-24-43(31)27-28-13-11-10-12-14-28/h15,28,30-34H,10-14,16-27H2,1-9H3/t30?,31-,32?,33?,34-,38+,39-,40-,41+/m1/s1 |
| InChiKey: | InChIKey=BLZLKNDUBQHSLT-NTXKOIRTSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.