* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXI-NATURAL 103_Y02A093 |
| English Synonyms: | WUXI-NATURAL 103_Y02A093 |
| MDL Number.: | MFCD21334141 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(C[C@@H]6[C@H](C5(C)C)N(CCN6C(=O)CCOC)C)C)C)C2C1)C)C(=O)OC)C |
| InChi: | InChI=1S/C38H62N2O4/c1-33(2)16-18-38(32(42)44-10)19-17-36(6)25(26(38)23-33)11-12-29-35(5)24-27-31(34(3,4)28(35)13-15-37(29,36)7)39(8)20-21-40(27)30(41)14-22-43-9/h11,26-29,31H,12-24H2,1-10H3/t26?,27-,28?,29?,31-,35+,36-,37-,38+/m1/s1 |
| InChiKey: | InChIKey=YVKMEEIVTPYPAF-IJUCVOFCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.