* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 103_Y02A095 |
English Synonyms: | WUXI-NATURAL 103_Y02A095 |
MDL Number.: | MFCD21334143 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(C[C@@H]6[C@H](C5(C)C)N(CCN6S(=O)(=O)C)C)C)C)C2C1)C)C(=O)OC)C |
InChi: | InChI=1S/C35H58N2O4S/c1-30(2)15-17-35(29(38)41-9)18-16-33(6)23(24(35)21-30)11-12-27-32(5)22-25-28(36(8)19-20-37(25)42(10,39)40)31(3,4)26(32)13-14-34(27,33)7/h11,24-28H,12-22H2,1-10H3/t24?,25-,26?,27?,28-,32+,33-,34-,35+/m1/s1 |
InChiKey: | InChIKey=NQZPENVETUZRTC-VELIAHJFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.