* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXI-NATURAL 103_Y02A098 |
| English Synonyms: | WUXI-NATURAL 103_Y02A098 |
| MDL Number.: | MFCD21334146 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(C[C@@H]6[C@H](C5(C)C)N(CCN6S(=O)(=O)C7CC7)C)C)C)C2C1)C)C(=O)OC)C |
| InChi: | InChI=1S/C37H60N2O4S/c1-32(2)16-18-37(31(40)43-9)19-17-35(6)25(26(37)22-32)12-13-29-34(5)23-27-30(33(3,4)28(34)14-15-36(29,35)7)38(8)20-21-39(27)44(41,42)24-10-11-24/h12,24,26-30H,10-11,13-23H2,1-9H3/t26?,27-,28?,29?,30-,34+,35-,36-,37+/m1/s1 |
| InChiKey: | InChIKey=MGTXLJLNCKZEBF-DEMIQVAFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.