* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 103_Y02A099 |
English Synonyms: | WUXI-NATURAL 103_Y02A099 |
MDL Number.: | MFCD21334147 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CC(C)NC(=O)N1CCN([C@@H]2[C@H]1C[C@]3(C(C2(C)C)CC[C@@]4(C3CC=C5[C@]4(CC[C@@]6(C5CC(CC6)(C)C)C(=O)OC)C)C)C)C |
InChi: | InChI=1S/C38H63N3O3/c1-24(2)39-32(43)41-21-20-40(10)30-27(41)23-35(7)28(34(30,5)6)14-15-37(9)29(35)13-12-25-26-22-33(3,4)16-18-38(26,31(42)44-11)19-17-36(25,37)8/h12,24,26-30H,13-23H2,1-11H3,(H,39,43)/t26?,27-,28?,29?,30-,35+,36-,37-,38+/m1/s1 |
InChiKey: | InChIKey=SINCOJMAVYQNCE-XYJSODIWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.