* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 103_Y02A102 |
English Synonyms: | WUXI-NATURAL 103_Y02A102 |
MDL Number.: | MFCD21334150 |
H bond acceptor: | 7 |
H bond donor: | 0 |
Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(C[C@@H]6[C@H](C5(C)C)N(CCN6C(=O)N7CCOCC7)C)C)C)C2C1)C)C(=O)OC)C |
InChi: | InChI=1S/C39H63N3O4/c1-34(2)14-16-39(32(43)45-9)17-15-37(6)26(27(39)24-34)10-11-30-36(5)25-28-31(35(3,4)29(36)12-13-38(30,37)7)40(8)18-19-42(28)33(44)41-20-22-46-23-21-41/h10,27-31H,11-25H2,1-9H3/t27?,28-,29?,30?,31-,36+,37-,38-,39+/m1/s1 |
InChiKey: | InChIKey=NTKZWHVWWCVUOQ-GOMKGDIXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.