* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL 103_Y02A103 |
English Synonyms: | WUXI-NATURAL 103_Y02A103 |
MDL Number.: | MFCD21334151 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(C[C@@H]6[C@H](C5(C)C)N(CCN6C(=O)CC7CCCC7)C)C)C)C2C1)C)C(=O)OC)C |
InChi: | InChI=1S/C41H66N2O3/c1-36(2)18-20-41(35(45)46-9)21-19-39(6)28(29(41)25-36)14-15-32-38(5)26-30-34(37(3,4)31(38)16-17-40(32,39)7)42(8)22-23-43(30)33(44)24-27-12-10-11-13-27/h14,27,29-32,34H,10-13,15-26H2,1-9H3/t29?,30-,31?,32?,34-,38+,39-,40-,41+/m1/s1 |
InChiKey: | InChIKey=RNQQWXDBACYLJV-MOOOVFQBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.