* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 5,6,7,8-TETRAHYDROIMIDAZO[1,2-A]PYRIDIN-6-OL |
| CAS: | 1100750-16-0 |
| English Synonyms: | 5,6,7,8-TETRAHYDROIMIDAZO[1,2-A]PYRIDIN-6-OL |
| MDL Number.: | MFCD21336103 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1cn2c(n1)CCC(C2)O |
| InChi: | InChI=1S/C7H10N2O/c10-6-1-2-7-8-3-4-9(7)5-6/h3-4,6,10H,1-2,5H2 |
| InChiKey: | InChIKey=QBXYDBADRJEYEN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.