* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX110665 |
English Synonyms: | WUXIAPPTEC WX110665 |
MDL Number.: | MFCD21362259 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | CC(C)(C)OC(=O)N[C@@]12CCC[C@@H]1CNC2 |
InChi: | InChI=1S/C12H22N2O2/c1-11(2,3)16-10(15)14-12-6-4-5-9(12)7-13-8-12/h9,13H,4-8H2,1-3H3,(H,14,15)/t9-,12-/m1/s1 |
InChiKey: | InChIKey=IOJANHDPMBVRLJ-BXKDBHETSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.