* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX111151 |
English Synonyms: | WUXIAPPTEC WX111151 |
MDL Number.: | MFCD21362270 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | CC(C)(C)OC(=O)N1C[C@@H]([C@@H]2[C@H]1CCCO2)NC(=O)OCc3ccccc3 |
InChi: | InChI=1S/C20H28N2O5/c1-20(2,3)27-19(24)22-12-15(17-16(22)10-7-11-25-17)21-18(23)26-13-14-8-5-4-6-9-14/h4-6,8-9,15-17H,7,10-13H2,1-3H3,(H,21,23)/t15-,16+,17+/m0/s1 |
InChiKey: | InChIKey=AEUXCDMHVQBTCJ-GVDBMIGSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.