* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX600156 |
English Synonyms: | WUXIAPPTEC WX600156 |
MDL Number.: | MFCD21362293 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | Cn1cc(nc1)CCN.Cl |
InChi: | InChI=1S/C6H11N3.ClH/c1-9-4-6(2-3-7)8-5-9;/h4-5H,2-3,7H2,1H3;1H |
InChiKey: | InChIKey=FQLGGDUOFSWKMS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.