* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX602084 |
English Synonyms: | WUXIAPPTEC WX602084 |
MDL Number.: | MFCD21362297 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | c1cc(c(c(c1)Br)N)N.Cl.Cl |
InChi: | InChI=1S/C6H7BrN2.2ClH/c7-4-2-1-3-5(8)6(4)9;;/h1-3H,8-9H2;2*1H |
InChiKey: | InChIKey=AXPMFYVMWDCVPS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.