* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX618348 |
English Synonyms: | WUXIAPPTEC WX618348 |
MDL Number.: | MFCD21362333 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | CCOC(=O)c1nc(cs1)c2ccncc2.Br |
InChi: | InChI=1S/C11H10N2O2S.BrH/c1-2-15-11(14)10-13-9(7-16-10)8-3-5-12-6-4-8;/h3-7H,2H2,1H3;1H |
InChiKey: | InChIKey=UJOZWZYKRREPOU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.