* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX626065 |
English Synonyms: | WUXIAPPTEC WX626065 |
MDL Number.: | MFCD21362351 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCOC(=O)c1cc(n[nH]1)C(=O)C |
InChi: | InChI=1S/C8H10N2O3/c1-3-13-8(12)7-4-6(5(2)11)9-10-7/h4H,3H2,1-2H3,(H,9,10) |
InChiKey: | InChIKey=DUGSTTIFTRKIBL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.