* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX642089 |
English Synonyms: | WUXIAPPTEC WX642089 |
MDL Number.: | MFCD21362369 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | c1ccc(cc1)COC(=O)N[C@H]2CCC[C@@H](C2)O |
InChi: | InChI=1S/C14H19NO3/c16-13-8-4-7-12(9-13)15-14(17)18-10-11-5-2-1-3-6-11/h1-3,5-6,12-13,16H,4,7-10H2,(H,15,17)/t12-,13-/m0/s1 |
InChiKey: | InChIKey=FYIZIYCXUSGNLZ-STQMWFEESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.