* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX660015 |
English Synonyms: | WUXIAPPTEC WX660015 |
MDL Number.: | MFCD21362378 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | C[C@@H]1CCCN([C@@H]1C(=O)O)C(=O)OC(C)(C)C |
InChi: | InChI=1S/C12H21NO4/c1-8-6-5-7-13(9(8)10(14)15)11(16)17-12(2,3)4/h8-9H,5-7H2,1-4H3,(H,14,15)/t8-,9+/m1/s1 |
InChiKey: | InChIKey=OBOHPFVTEILYQF-BDAKNGLRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.