* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GUANINE-15N5 |
| English Synonyms: | GUANINE-15N5 |
| MDL Number.: | MFCD21363633 |
| H bond acceptor: | 6 |
| H bond donor: | 3 |
| Smile: | c1[15nH]c2c([15n]1)c(=O)[15nH]c([15n]2)[15NH2] |
| InChi: | InChI=1S/C5H5N5O/c6-5-9-3-2(4(11)10-5)7-1-8-3/h1H,(H4,6,7,8,9,10,11)/i6+1,7+1,8+1,9+1,10+1 |
| InChiKey: | InChIKey=UYTPUPDQBNUYGX-CIKZIQIKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.