* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | KETO IMPURITY |
| English Synonyms: | KETO IMPURITY |
| MDL Number.: | MFCD21363679 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCCCN(CCCC)CC(c1cc(cc2c1-c3ccc(cc3C2=O)Cl)Cl)O |
| InChi: | InChI=1S/C23H27Cl2NO2/c1-3-5-9-26(10-6-4-2)14-21(27)19-12-16(25)13-20-22(19)17-8-7-15(24)11-18(17)23(20)28/h7-8,11-13,21,27H,3-6,9-10,14H2,1-2H3 |
| InChiKey: | InChIKey=DHSOIDFQNPRZLM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.