Molecular Structure:
CCD No.:CCD06424129
VITAMIN K1-D7
Formula:C31 H39 D7 O2
MolWeight:457.745
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | VITAMIN K1-D7 |
| English Synonyms： | VITAMIN K1-D7 |
| MDL Number.： | MFCD21363905 |
| H bond acceptor： | 2 |
| H bond donor： | 0 |
| Smile： | [2H]c1c(c(c2c(c1[2H])C(=O)C(=C(C2=O)C([2H])([2H])[2H])C/C=C(\C)/CCCC(C)CCCC(C)CCCC(C)C)[2H])[2H] |
| InChiKey： | InChIKey=null |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
