* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-NITRO-4-(PYRIDIN-2-YLMETHYL)-2H-BENZO[B][1,4]OXAZIN-3(4H)-ONE |
| CAS: | 120101-66-8 |
| English Synonyms: | 7-NITRO-4-(PYRIDIN-2-YLMETHYL)-2H-BENZO[B][1,4]OXAZIN-3(4H)-ONE |
| MDL Number.: | MFCD21603877 |
| H bond acceptor: | 7 |
| H bond donor: | 0 |
| Smile: | c1ccnc(c1)CN2c3ccc(cc3OCC2=O)[N+](=O)[O-] |
| InChi: | InChI=1S/C14H11N3O4/c18-14-9-21-13-7-11(17(19)20)4-5-12(13)16(14)8-10-3-1-2-6-15-10/h1-7H,8-9H2 |
| InChiKey: | InChIKey=BVXQKNPVJURLCC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.