* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PROPANOIC ACID,3-AMINO-2-CHLORO-3-OXO- |
| CAS: | 71501-30-9 |
| English Synonyms: | PROPANOIC ACID,3-AMINO-2-CHLORO-3-OXO- |
| MDL Number.: | MFCD21608048 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | C(C(=O)N)(C(=O)O)Cl |
| InChi: | InChI=1S/C3H4ClNO3/c4-1(2(5)6)3(7)8/h1H,(H2,5,6)(H,7,8) |
| InChiKey: | InChIKey=WRTQHIZEMSJYQK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.