* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | OTAVA-BB 4249426 |
| English Synonyms: | 6-ETHYL-2,3,4,9-TETRAHYDRO-1H-PYRIDO[3,4-B]INDOLE ; OTAVA-BB 4249426 |
| MDL Number.: | MFCD21985521 |
| H bond acceptor: | 2 |
| H bond donor: | 2 |
| Smile: | CCc1ccc2c(c1)c3c([nH]2)CNCC3 |
| InChi: | InChI=1S/C13H16N2/c1-2-9-3-4-12-11(7-9)10-5-6-14-8-13(10)15-12/h3-4,7,14-15H,2,5-6,8H2,1H3 |
| InChiKey: | InChIKey=OAUWDIIBJSJFJY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.