* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | XL-888 |
CAS: | 1149705-71-4 |
English Synonyms: | XL888 ; XL-888 |
MDL Number.: | MFCD22124888 |
H bond acceptor: | 8 |
H bond donor: | 3 |
Smile: | CC[C@@H](C)Nc1cc(c(cc1C(=O)N)C)C(=O)N[C@H]2C[C@@H]3CC[C@H](C2)N3c4ccc(cn4)C(=O)C5CC5 |
InChi: | InChI=1S/C29H37N5O3/c1-4-17(3)32-25-14-23(16(2)11-24(25)28(30)36)29(37)33-20-12-21-8-9-22(13-20)34(21)26-10-7-19(15-31-26)27(35)18-5-6-18/h7,10-11,14-15,17-18,20-22,32H,4-6,8-9,12-13H2,1-3H3,(H2,30,36)(H,33,37)/t17-,20-,21-,22+/m1/s1 |
InChiKey: | InChIKey=LHGWWAFKVCIILM-CIQXWFTPSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.