* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | INK-128 |
CAS: | 1224844-38-5 |
English Synonyms: | 3-(2-AMINO-5-BENZOXAZOLYL)-1-(1-METHYLETHYL)-1H-PYRAZOLO[3,4-D]PYRIMIDIN-4-AMINE ; INK 128 (MLN0128) ; INK-128 |
MDL Number.: | MFCD22124893 |
H bond acceptor: | 8 |
H bond donor: | 2 |
Smile: | CC(C)n1c2c(c(n1)c3ccc4c(c3)nc(o4)N)c(ncn2)N |
InChi: | InChI=1S/C15H15N7O/c1-7(2)22-14-11(13(16)18-6-19-14)12(21-22)8-3-4-10-9(5-8)20-15(17)23-10/h3-7H,1-2H3,(H2,17,20)(H2,16,18,19) |
InChiKey: | InChIKey=GYLDXIAOMVERTK-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.