* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-BROMO-2,4-DICHLOROQUINOLINE |
| CAS: | 406205-10-5 |
| English Synonyms: | 7-BROMO-2,4-DICHLOROQUINOLINE |
| MDL Number.: | MFCD22200006 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | c1cc2c(cc1Br)nc(cc2Cl)Cl |
| InChi: | InChI=1S/C9H4BrCl2N/c10-5-1-2-6-7(11)4-9(12)13-8(6)3-5/h1-4H |
| InChiKey: | InChIKey=UFUBSBVMOXXACP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.