* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VALINE NITRATE |
| English Synonyms: | VALINE NITRATE |
| MDL Number.: | MFCD22200130 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | CC(C)[C@@H](C(=O)O)N.[N+](=O)(O)[O-] |
| InChi: | InChI=1S/C5H11NO2.HNO3/c1-3(2)4(6)5(7)8;2-1(3)4/h3-4H,6H2,1-2H3,(H,7,8);(H,2,3,4)/t4-;/m0./s1 |
| InChiKey: | InChIKey=DBBFFYXLECNESF-WCCKRBBISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.