* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-ISOPROPYL-1H-PURIN-6(9H)-ONE |
| CAS: | 227955-03-5 |
| English Synonyms: | 8-ISOPROPYL-1H-PURIN-6(9H)-ONE |
| MDL Number.: | MFCD22207566 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | CC(C)c1[nH]c2c(n1)c(=O)[nH]cn2 |
| InChi: | InChI=1S/C8H10N4O/c1-4(2)6-11-5-7(12-6)9-3-10-8(5)13/h3-4H,1-2H3,(H2,9,10,11,12,13) |
| InChiKey: | InChIKey=CZKBGEOHCCZULP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.