* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX110514 |
English Synonyms: | WUXIAPPTEC WX110514 |
MDL Number.: | MFCD22209385 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CC(C)(C)OC(=O)N1C[C@H]([C@@H]2[C@H]1CCCO2)N |
InChi: | InChI=1S/C12H22N2O3/c1-12(2,3)17-11(15)14-7-8(13)10-9(14)5-4-6-16-10/h8-10H,4-7,13H2,1-3H3/t8-,9-,10-/m1/s1 |
InChiKey: | InChIKey=NJLKXALZQYGBFI-OPRDCNLKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.