* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX116022 |
English Synonyms: | WUXIAPPTEC WX116022 |
MDL Number.: | MFCD22209392 |
H bond acceptor: | 8 |
H bond donor: | 1 |
Smile: | CC(C)(C)OC(=O)N1C[C@H]2C[C@@]3(CN(C[C@@H]3[C@H]2C1)C(=O)OCc4ccccc4)C(=O)O |
InChi: | InChI=1S/C23H30N2O6/c1-22(2,3)31-21(29)24-10-16-9-23(19(26)27)14-25(12-18(23)17(16)11-24)20(28)30-13-15-7-5-4-6-8-15/h4-8,16-18H,9-14H2,1-3H3,(H,26,27)/t16-,17+,18-,23+/m1/s1 |
InChiKey: | InChIKey=NMANLUQNKQTXFI-MIVHDCIWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.