* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXIAPPTEC WX110399 |
| English Synonyms: | WUXIAPPTEC WX110399 |
| MDL Number.: | MFCD22209664 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | CC(C)(C)OC(=O)N1C[C@@H]2[C@@H](CCS(=O)(=O)[C@@H]2C1)C(=O)O |
| InChi: | InChI=1S/C13H21NO6S/c1-13(2,3)20-12(17)14-6-9-8(11(15)16)4-5-21(18,19)10(9)7-14/h8-10H,4-7H2,1-3H3,(H,15,16)/t8-,9-,10-/m1/s1 |
| InChiKey: | InChIKey=OKJKVSKEBWHJLR-OPRDCNLKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.