* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX106144 |
English Synonyms: | WUXIAPPTEC WX106144 |
MDL Number.: | MFCD22209769 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | CC(C)(C)OC(=O)N1CCCC2(C1)CNc3c2cc(cc3)CN |
InChi: | InChI=1S/C18H27N3O2/c1-17(2,3)23-16(22)21-8-4-7-18(12-21)11-20-15-6-5-13(10-19)9-14(15)18/h5-6,9,20H,4,7-8,10-12,19H2,1-3H3 |
InChiKey: | InChIKey=VKNYIPMPKPEDSY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.