Molecular Structure:
CCD No.:CCD07369079
JALOR-CHEM I14-12317
Formula:C12 H13 N O
MolWeight:187.241
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | JALOR-CHEM I14-12317 |
| English Synonyms： | JALOR-CHEM I14-12317 |
| MDL Number.： | MFCD22380831 |
| H bond acceptor： | 2 |
| H bond donor： | 1 |
| Smile： | c1ccc2c(c1)C(=O)CC23CCNC3 |
| InChi： | InChI=1S/C12H13NO/c14-11-7-12(5-6-13-8-12)10-4-2-1-3-9(10)11/h1-4,13H,5-8H2 |
| InChiKey： | InChIKey=FAYNEFVOIGLETE-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
