* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | XYLOPINE |
| English Synonyms: | XYLOPINE |
| MDL Number.: | MFCD22380939 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | COc1ccc-2c(c1)C[C@@H]3c4c2c5c(cc4CCN3)OCO5 |
| InChi: | InChI=1S/C18H17NO3/c1-20-12-2-3-13-11(6-12)7-14-16-10(4-5-19-14)8-15-18(17(13)16)22-9-21-15/h2-3,6,8,14,19H,4-5,7,9H2,1H3/t14-/m1/s1 |
| InChiKey: | InChIKey=RFWCCZDSXIZJMF-CQSZACIVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.