* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | [1,1'-BIPYRROLE]-2,2',5,5'-TETRAONE |
CAS: | 6903-84-0 |
English Synonyms: | BIS-(DIMETHYLMALEIC)-HYDRAZIDE ; [1,1'-BIPYRROLE]-2,2',5,5'-TETRAONE |
MDL Number.: | MFCD22381063 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | C1=CC(=O)N(C1=O)N2C(=O)C=CC2=O |
InChi: | InChI=1S/C8H4N2O4/c11-5-1-2-6(12)9(5)10-7(13)3-4-8(10)14/h1-4H |
InChiKey: | InChIKey=PCNTZEWNQWMZCG-UHFFFAOYSA-N |
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.