* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GDC-0349 |
| CAS: | 1207360-89-1 |
| English Synonyms: | GDC-0349 |
| MDL Number.: | MFCD22417087 |
| H bond acceptor: | 9 |
| H bond donor: | 2 |
| Smile: | CCNC(=O)Nc1ccc(cc1)c2nc3c(c(n2)N4CCOC[C@@H]4C)CCN(C3)C5COC5 |
| InChi: | InChI=1S/C24H32N6O3/c1-3-25-24(31)26-18-6-4-17(5-7-18)22-27-21-12-29(19-14-33-15-19)9-8-20(21)23(28-22)30-10-11-32-13-16(30)2/h4-7,16,19H,3,8-15H2,1-2H3,(H2,25,26,31)/t16-/m0/s1 |
| InChiKey: | InChIKey=RGJOJUGRHPQXGF-INIZCTEOSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.