* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | KETONE ESTER |
| CAS: | 1208313-97-6 |
| English Synonyms: | KETONE ESTER |
| MDL Number.: | MFCD22417094 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | C[C@H](CCOC(=O)C[C@@H](C)O)O |
| InChi: | InChI=1S/C8H16O4/c1-6(9)3-4-12-8(11)5-7(2)10/h6-7,9-10H,3-5H2,1-2H3/t6-,7-/m1/s1 |
| InChiKey: | InChIKey=AOWPVIWVMWUSBD-RNFRBKRXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.