Molecular Structure:
CCD No.:CCD07396058
VD3-D6
CAS No.:
118584-54-6
Formula:C27 H38 D6 O
MolWeight:390.68
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(4)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(4)
|
|
| Product Name： | VD3-D6 |
| CAS： | 118584-54-6 |
| English Synonyms： | VD3-D6 |
| MDL Number.： | MFCD22417102 |
| H bond acceptor： | 1 |
| H bond donor： | 1 |
| Smile： | [2H]C([2H])([2H])C(CCC[C@@H](C)[C@H]1CC[C@@H]\2[C@@]1(CCC/C2=C\C=C/3\C[C@H](CCC3=C)O)C)C([2H])([2H])[2H] |
| InChiKey： | InChIKey=null |
|
|
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
