* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VAILLANTINE |
| CAS: | 53964-96-8 |
| English Synonyms: | VAILLANTINE |
| MDL Number.: | MFCD22417299 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CN1CCc2cc(c(cc2C(=O)Cc3ccc(c(c3C1)OC)OC)O)O |
| InChi: | InChI=1S/C20H23NO5/c1-21-7-6-13-9-17(23)18(24)10-14(13)16(22)8-12-4-5-19(25-2)20(26-3)15(12)11-21/h4-5,9-10,23-24H,6-8,11H2,1-3H3 |
| InChiKey: | InChIKey=KERJSZZMJYDUGO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.