* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITEXDOIN A |
| CAS: | 1186021-77-1 |
| English Synonyms: | VITEXDOIN A |
| MDL Number.: | MFCD22417310 |
| H bond acceptor: | 6 |
| H bond donor: | 4 |
| Smile: | COc1cc(ccc1O)[C@H]2c3cc(c(cc3C=C([C@@H]2CO)C=O)O)O |
| InChi: | InChI=1S/C19H18O6/c1-25-18-6-10(2-3-15(18)22)19-13-7-17(24)16(23)5-11(13)4-12(8-20)14(19)9-21/h2-8,14,19,21-24H,9H2,1H3/t14-,19-/m0/s1 |
| InChiKey: | InChIKey=PNRPRUVCFFHMMC-LIRRHRJNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.