* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GARBANZOL |
| CAS: | 1226-22-8 |
| English Synonyms: | GARBANZOL |
| MDL Number.: | MFCD22417313 |
| H bond acceptor: | 5 |
| H bond donor: | 3 |
| Smile: | c1cc(ccc1[C@@H]2[C@H](C(=O)c3ccc(cc3O2)O)O)O |
| InChi: | InChI=1S/C15H12O5/c16-9-3-1-8(2-4-9)15-14(19)13(18)11-6-5-10(17)7-12(11)20-15/h1-7,14-17,19H/t14-,15+/m0/s1 |
| InChiKey: | InChIKey=VRTGGIJPIYOHGT-LSDHHAIUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.