* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | JALOR-CHEM I02-2470 |
| English Synonyms: | JALOR-CHEM I02-2470 |
| MDL Number.: | MFCD22422404 |
| H bond acceptor: | 8 |
| H bond donor: | 0 |
| Smile: | B1(OC(C(O1)(C)C)(C)C)c2cc(c(nc2)Cl)N(S(=O)(=O)CC)S(=O)(=O)CC |
| InChi: | InChI=1S/C15H24BClN2O6S2/c1-7-26(20,21)19(27(22,23)8-2)12-9-11(10-18-13(12)17)16-24-14(3,4)15(5,6)25-16/h9-10H,7-8H2,1-6H3 |
| InChiKey: | InChIKey=YBNYTKSYDFMWJE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.