* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | JALOR-CHEM I09-1673 |
| English Synonyms: | JALOR-CHEM I09-1673 |
| MDL Number.: | MFCD22422559 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | CCCCC(C)C(=O)OC=S |
| InChi: | InChI=1S/C8H14O2S/c1-3-4-5-7(2)8(9)10-6-11/h6-7H,3-5H2,1-2H3 |
| InChiKey: | InChIKey=QVWQKFDKMVUMEA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.