* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | JALOR-CHEM I09-1778 |
| English Synonyms: | JALOR-CHEM I09-1778 |
| MDL Number.: | MFCD22422561 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | CC(CC1OCCS1)S |
| InChi: | InChI=1S/C6H12OS2/c1-5(8)4-6-7-2-3-9-6/h5-6,8H,2-4H2,1H3 |
| InChiKey: | InChIKey=RLVDBSHCHIZQPW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.