Molecular Structure:
CCD No.:CCD07401112
JALOR-CHEM I14-12318
Formula:C12 H12 F3 N O
MolWeight:243.227
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | JALOR-CHEM I14-12318 |
| English Synonyms： | JALOR-CHEM I14-12318 |
| MDL Number.： | MFCD22422696 |
| H bond acceptor： | 2 |
| H bond donor： | 1 |
| Smile： | c1cc2c(cc1C(F)(F)F)C3(CCNC3)CO2 |
| InChi： | InChI=1S/C12H12F3NO/c13-12(14,15)8-1-2-10-9(5-8)11(7-17-10)3-4-16-6-11/h1-2,5,16H,3-4,6-7H2 |
| InChiKey： | InChIKey=YIFAPNRTOBLZIM-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
