Molecular Structure:
CCD No.:CCD07401113
JALOR-CHEM I14-12322
Formula:C11 H13 N O . Cl H
MolWeight:211.691
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(1)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | JALOR-CHEM I14-12322 |
| English Synonyms： | JALOR-CHEM I14-12322 |
| MDL Number.： | MFCD22422697 |
| H bond acceptor： | 2 |
| H bond donor： | 1 |
| Smile： | c1ccc2c(c1)CCC3(O2)CNC3.Cl |
| InChi： | InChI=1S/C11H13NO.ClH/c1-2-4-10-9(3-1)5-6-11(13-10)7-12-8-11;/h1-4,12H,5-8H2;1H |
| InChiKey： | InChIKey=MAYRRZJACPRBII-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
